Compound Q&A

How is DIDS sodium salt (CAS: 67483-13-0) typically synthesized?

Answer

DIDS sodium salt
DIDS sodium salt (CAS: 67483-13-0) is synthesized by the reaction of diisothiocyanate with sodium hydroxide. The synthesis typically involves mild conditions, and the product is purified by crystallization. The yield is generally high, and the process can be carried out with the use of a mild catalyst to improve selectivity.

About

CAS No 67483-13-0
English Name DIDS sodium salt
Molecular Formula C16H8N2Na2O6S4
Molecular Weight 498.5 g/mol
SMILES C1=CC(=C(C=C1N=C=S)S(=O)(=O)[O-])C=CC2=C(C=C(C=C2)N=C=S)S(=O)(=O)[O-].[Na+].[Na+]
InChIKey GEPAYBXVXXBSKP-SEPHDYHBSA-L
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of DIDS sodium salt (CAS: 67483-13-0)?

DIDS sodium salt (CAS: 67483-13-0) is a crystalline solid with a molecular weight of approximately 3...

Compound Q&A

What industries use DIDS sodium salt (CAS: 67483-13-0)?

DIDS sodium salt (CAS: 67483-13-0) is primarily used in the pharmaceutical industry for its inhibito...

Compound Q&A

What precautions should be taken when handling DIDS sodium salt (CAS: 67483-13-0)?

When handling DIDS sodium salt (CAS: 67483-13-0), it is important to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...