Compound Q&A

What are the physical and chemical properties of DIDS sodium salt (CAS: 67483-13-0)?

Answer

DIDS sodium salt
DIDS sodium salt (CAS: 67483-13-0) is a crystalline solid with a molecular weight of approximately 337.99 g/mol. It has a high solubility in water and is poorly soluble in organic solvents. Chemically, it is known for its reactivity as a sulfhydryl oxidase inhibitor and is often used in biological assays.

About

CAS No 67483-13-0
English Name DIDS sodium salt
Molecular Formula C16H8N2Na2O6S4
Molecular Weight 498.5 g/mol
SMILES C1=CC(=C(C=C1N=C=S)S(=O)(=O)[O-])C=CC2=C(C=C(C=C2)N=C=S)S(=O)(=O)[O-].[Na+].[Na+]
InChIKey GEPAYBXVXXBSKP-SEPHDYHBSA-L
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

How is DIDS sodium salt (CAS: 67483-13-0) typically synthesized?

DIDS sodium salt (CAS: 67483-13-0) is synthesized by the reaction of diisothiocyanate with sodium hy...

Compound Q&A

What industries use DIDS sodium salt (CAS: 67483-13-0)?

DIDS sodium salt (CAS: 67483-13-0) is primarily used in the pharmaceutical industry for its inhibito...

Compound Q&A

What precautions should be taken when handling DIDS sodium salt (CAS: 67483-13-0)?

When handling DIDS sodium salt (CAS: 67483-13-0), it is important to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...