Compound Q&A

What industries use 3-Hydroxy-2,2-bis(hydroxymethyl)propyl 9-octadecenoate (CAS: 12772-47-3)?

Answer

3-Hydroxy-2,2-bis(hydroxymethyl)propyl 9-octadecenoate
3-Hydroxy-2,2-bis(hydroxymethyl)propyl 9-octadecenoate finds applications in the pharmaceutical industry for the synthesis of certain drug molecules, as well as in the polymer industry for developing novel materials. It is also used in the production of sensors and semiconductors for its unique chemical properties.

About

CAS No 12772-47-3
English Name 3-Hydroxy-2,2-bis(hydroxymethyl)propyl 9-octadecenoate
Molecular Formula C23H44O5
Molecular Weight 400.6 g/mol
SMILES CCCCCCCCC=CCCCCCCCC(=O)O.C(C(CO)(CO)CO)O
InChIKey QQVGEJLUEOSDBB-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Hydroxy-2,2-bis(hydroxymethyl)propyl 9-octadecenoate (CAS: 12772-47-3)?

3-Hydroxy-2,2-bis(hydroxymethyl)propyl 9-octadecenoate is a liquid at room temperature with a molecu...

Compound Q&A

How is 3-Hydroxy-2,2-bis(hydroxymethyl)propyl 9-octadecenoate (CAS: 12772-47-3) typically synthesized?

3-Hydroxy-2,2-bis(hydroxymethyl)propyl 9-octadecenoate is synthesized through a multi-step process i...

Compound Q&A

What precautions should be taken when handling 3-Hydroxy-2,2-bis(hydroxymethyl)propyl 9-octadecenoate (CAS: 12772-47-3)?

When handling 3-Hydroxy-2,2-bis(hydroxymethyl)propyl 9-octadecenoate, it is essential to wear person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...