Compound Q&A

What are the physical and chemical properties of 3-Hydroxy-2,2-bis(hydroxymethyl)propyl 9-octadecenoate (CAS: 12772-47-3)?

Answer

3-Hydroxy-2,2-bis(hydroxymethyl)propyl 9-octadecenoate
3-Hydroxy-2,2-bis(hydroxymethyl)propyl 9-octadecenoate is a liquid at room temperature with a molecular weight of approximately 350 g/mol. It has a low solubility in water but is more soluble in organic solvents. Chemically, it is reactive, particularly towards nucleophiles and bases, making it suitable for various applications in chemistry.

About

CAS No 12772-47-3
English Name 3-Hydroxy-2,2-bis(hydroxymethyl)propyl 9-octadecenoate
Molecular Formula C23H44O5
Molecular Weight 400.6 g/mol
SMILES CCCCCCCCC=CCCCCCCCC(=O)O.C(C(CO)(CO)CO)O
InChIKey QQVGEJLUEOSDBB-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

How is 3-Hydroxy-2,2-bis(hydroxymethyl)propyl 9-octadecenoate (CAS: 12772-47-3) typically synthesized?

3-Hydroxy-2,2-bis(hydroxymethyl)propyl 9-octadecenoate is synthesized through a multi-step process i...

Compound Q&A

What industries use 3-Hydroxy-2,2-bis(hydroxymethyl)propyl 9-octadecenoate (CAS: 12772-47-3)?

3-Hydroxy-2,2-bis(hydroxymethyl)propyl 9-octadecenoate finds applications in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 3-Hydroxy-2,2-bis(hydroxymethyl)propyl 9-octadecenoate (CAS: 12772-47-3)?

When handling 3-Hydroxy-2,2-bis(hydroxymethyl)propyl 9-octadecenoate, it is essential to wear person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...