Compound Q&A

What industries use tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride (CAS: 929302-18-1)?

Answer

tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride
tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride is primarily used in the pharmaceutical industry for the synthesis of complex molecules and in the field of polymer chemistry for the development of functional polymers. It is also used in the production of sensors and as a precursor in semiconductor manufacturing processes.

About

English Name tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride
Molecular Formula C12H23ClN2O2
Molecular Weight 262.78 g/mol
SMILES CC(C)(C)OC(=O)N1CC2(C1)CCNCC2.Cl
InChIKey SZACTFROZQQOJB-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride (CAS: 929302-18-1)?

tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride is a crystalline solid with a mole...

Compound Q&A

How is tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride (CAS: 929302-18-1) typically synthesized?

tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride is typically synthesized via a mul...

Compound Q&A

What precautions should be taken when handling tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride (CAS: 929302-18-1)?

When handling tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride, it is important to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...