Compound Q&A

What are the physical and chemical properties of tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride (CAS: 929302-18-1)?

Answer

tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride
tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride is a crystalline solid with a molecular weight of approximately 288.32 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and acetone. The compound is reactive towards nucleophiles and can undergo nucleophilic substitution reactions. It is stable under normal laboratory conditions but should be stored in a cool, dry place to prevent hydrolysis.

About

English Name tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride
Molecular Formula C12H23ClN2O2
Molecular Weight 262.78 g/mol
SMILES CC(C)(C)OC(=O)N1CC2(C1)CCNCC2.Cl
InChIKey SZACTFROZQQOJB-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

How is tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride (CAS: 929302-18-1) typically synthesized?

tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride is typically synthesized via a mul...

Compound Q&A

What industries use tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride (CAS: 929302-18-1)?

tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride is primarily used in the pharmaceu...

Compound Q&A

What precautions should be taken when handling tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride (CAS: 929302-18-1)?

When handling tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride, it is important to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...