Compound Q&A

What industries use 4-Bromo-2-chloro-1,3-benzothiazole (CAS: 182344-57-6)?

Answer

4-Bromo-2-chloro-1,3-benzothiazole
4-Bromo-2-chloro-1,3-benzothiazole is primarily used in the pharmaceutical industry for the synthesis of various medicinal compounds. It also finds applications in the polymer industry as a stabilizer and in the development of sensors. Additionally, it is used in the semiconductor industry for specific chemical processes.

About

English Name 4-Bromo-2-chloro-1,3-benzothiazole
Molecular Formula C7H3BrClNS
Molecular Weight 248.53 g/mol
SMILES C1=CC2=C(C(=C1)Br)N=C(S2)Cl
InChIKey HWPFBBVUHHRYMR-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-2-chloro-1,3-benzothiazole (CAS: 182344-57-6)?

4-Bromo-2-chloro-1,3-benzothiazole is a yellow crystalline solid with a molecular weight of approxim...

Compound Q&A

How is 4-Bromo-2-chloro-1,3-benzothiazole (CAS: 182344-57-6) typically synthesized?

4-Bromo-2-chloro-1,3-benzothiazole is usually synthesized by the reaction of 2-chloro-1,3-benzothiaz...

Compound Q&A

What precautions should be taken when handling 4-Bromo-2-chloro-1,3-benzothiazole (CAS: 182344-57-6)?

When handling 4-Bromo-2-chloro-1,3-benzothiazole, it is important to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...