Compound Q&A

What are the physical and chemical properties of 4-Bromo-2-chloro-1,3-benzothiazole (CAS: 182344-57-6)?

Answer

4-Bromo-2-chloro-1,3-benzothiazole
4-Bromo-2-chloro-1,3-benzothiazole is a yellow crystalline solid with a molecular weight of approximately 272.03 g/mol. It is sparingly soluble in water but soluble in organic solvents like ethanol and acetonitrile. The compound is known for its low reactivity and stability under normal conditions. It can undergo substitution reactions and exhibits good thermal stability.

About

English Name 4-Bromo-2-chloro-1,3-benzothiazole
Molecular Formula C7H3BrClNS
Molecular Weight 248.53 g/mol
SMILES C1=CC2=C(C(=C1)Br)N=C(S2)Cl
InChIKey HWPFBBVUHHRYMR-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

How is 4-Bromo-2-chloro-1,3-benzothiazole (CAS: 182344-57-6) typically synthesized?

4-Bromo-2-chloro-1,3-benzothiazole is usually synthesized by the reaction of 2-chloro-1,3-benzothiaz...

Compound Q&A

What industries use 4-Bromo-2-chloro-1,3-benzothiazole (CAS: 182344-57-6)?

4-Bromo-2-chloro-1,3-benzothiazole is primarily used in the pharmaceutical industry for the synthesi...

Compound Q&A

What precautions should be taken when handling 4-Bromo-2-chloro-1,3-benzothiazole (CAS: 182344-57-6)?

When handling 4-Bromo-2-chloro-1,3-benzothiazole, it is important to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...