Compound Q&A

How is 2-Methyl-1-octyl-1H-indole (CAS: 42951-39-3) typically synthesized?

Answer

2-Methyl-1-octyl-1H-indole
2-Methyl-1-octyl-1H-indole is typically synthesized through an indole synthesis route involving the coupling of an indole derivative with a 1-octylmagnesium bromide in the presence of a suitable base like potassium carbonate. This method provides good selectivity and yield. Alternatively, it can be synthesized via a condensation reaction between 1-octylamine and indole using a suitable catalyst such as a Lewis acid or a palladium-based catalyst.

About

CAS No 42951-39-3
English Name 2-Methyl-1-octyl-1H-indole
Molecular Formula C17H25N
Molecular Weight 243.39 g/mol
SMILES CCCCCCCCN1C(=CC2=CC=CC=C21)C
InChIKey MOVCYDNEZZZSLV-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-1-octyl-1H-indole (CAS: 42951-39-3)?

2-Methyl-1-octyl-1H-indole is a solid with a crystalline form. Its molecular weight is approximately...

Compound Q&A

What industries use 2-Methyl-1-octyl-1H-indole (CAS: 42951-39-3)?

2-Methyl-1-octyl-1H-indole (CAS: 42951-39-3) is primarily used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 2-Methyl-1-octyl-1H-indole (CAS: 42951-39-3)?

When handling 2-Methyl-1-octyl-1H-indole (CAS: 42951-39-3), it is important to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...