Compound Q&A

What industries use 1,2-Difluoro-3-methyl-4-nitrobenzene (CAS: 914348-35-9)?

Answer

1,2-Difluoro-3-methyl-4-nitrobenzene
1,2-Difluoro-3-methyl-4-nitrobenzene (CAS: 914348-35-9) is primarily used in the pharmaceutical and polymer industries. It serves as a precursor in the synthesis of various medicinal compounds and also finds applications in the development of advanced polymers due to its unique chemical properties.

About

English Name 1,2-Difluoro-3-methyl-4-nitrobenzene
Molecular Formula C7H5F2NO2
Molecular Weight 173.12 g/mol
SMILES CC1=C(C=CC(=C1F)F)[N+](=O)[O-]
InChIKey ODMLBEQUDLHJMW-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2-Difluoro-3-methyl-4-nitrobenzene (CAS: 914348-35-9)?

1,2-Difluoro-3-methyl-4-nitrobenzene (CAS: 914348-35-9) is a crystalline compound with a molecular w...

Compound Q&A

How is 1,2-Difluoro-3-methyl-4-nitrobenzene (CAS: 914348-35-9) typically synthesized?

1,2-Difluoro-3-methyl-4-nitrobenzene (CAS: 914348-35-9) can be synthesized through the nitration of ...

Compound Q&A

What precautions should be taken when handling 1,2-Difluoro-3-methyl-4-nitrobenzene (CAS: 914348-35-9)?

When handling 1,2-Difluoro-3-methyl-4-nitrobenzene (CAS: 914348-35-9), it is important to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...