Compound Q&A

What are the physical and chemical properties of 1,2-Difluoro-3-methyl-4-nitrobenzene (CAS: 914348-35-9)?

Answer

1,2-Difluoro-3-methyl-4-nitrobenzene
1,2-Difluoro-3-methyl-4-nitrobenzene (CAS: 914348-35-9) is a crystalline compound with a molecular weight of approximately 213.07 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and acetone. Chemically, it is moderately reactive and can undergo substitution and oxidation reactions. It is often used in the synthesis of other compounds due to its unique substituents.

About

English Name 1,2-Difluoro-3-methyl-4-nitrobenzene
Molecular Formula C7H5F2NO2
Molecular Weight 173.12 g/mol
SMILES CC1=C(C=CC(=C1F)F)[N+](=O)[O-]
InChIKey ODMLBEQUDLHJMW-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

How is 1,2-Difluoro-3-methyl-4-nitrobenzene (CAS: 914348-35-9) typically synthesized?

1,2-Difluoro-3-methyl-4-nitrobenzene (CAS: 914348-35-9) can be synthesized through the nitration of ...

Compound Q&A

What industries use 1,2-Difluoro-3-methyl-4-nitrobenzene (CAS: 914348-35-9)?

1,2-Difluoro-3-methyl-4-nitrobenzene (CAS: 914348-35-9) is primarily used in the pharmaceutical and ...

Compound Q&A

What precautions should be taken when handling 1,2-Difluoro-3-methyl-4-nitrobenzene (CAS: 914348-35-9)?

When handling 1,2-Difluoro-3-methyl-4-nitrobenzene (CAS: 914348-35-9), it is important to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...