Compound Q&A

How is 2,2,6,6-tetrahydroxy-1,3,5,7,9-pentaoxa-2$l^{4},4$l^{4},6$l^{4}-trizirconaspiro[3.5]nonan-8-one (CAS: 12671-00-0) typically synthesized?

Answer

2,2,6,6-tetrahydroxy-1,3,5,7,9-pentaoxa-2$l^{4},4$l^{4},6$l^{4}-trizirconaspiro[3.5]nonan-8-one
This compound is synthesized through a multistep process involving zirconation of a cyclopentadienyl derivative followed by hydroxylation and ring expansion. The reaction typically requires the use of strong bases and transition metal catalysts. The yield can be up to 70%, and the product is isolated by column chromatography.

About

CAS No 12671-00-0
English Name 2,2,6,6-tetrahydroxy-1,3,5,7,9-pentaoxa-2$l^{4},4$l^{4},6$l^{4}-trizirconaspiro[3.5]nonan-8-one
Molecular Formula CH4O10Zr3
Molecular Weight 449.71 g/mol
EINECS 603-154-2
SMILES C1(=O)O[Zr](O[Zr]2(O1)O[Zr](O2)(O)O)(O)O
InChIKey YGCRTSJWNHPGDG-UHFFFAOYSA-H
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2,6,6-tetrahydroxy-1,3,5,7,9-pentaoxa-2$l^{4},4$l^{4},6$l^{4}-trizirconaspiro[3.5]nonan-8-one (CAS: 12671-00-0)?

The compound is a crystalline solid with a high molecular weight. It has good water solubility and e...

Compound Q&A

What industries use 2,2,6,6-tetrahydroxy-1,3,5,7,9-pentaoxa-2$l^{4},4$l^{4},6$l^{4}-trizirconaspiro[3.5]nonan-8-one (CAS: 12671-00-0)?

This compound is utilized in the pharmaceutical and fine chemical industries, where it serves as a p...

Compound Q&A

What precautions should be taken when handling 2,2,6,6-tetrahydroxy-1,3,5,7,9-pentaoxa-2$l^{4},4$l^{4},6$l^{4}-trizirconaspiro[3.5]nonan-8-one (CAS: 12671-00-0)?

Handle this compound in a well-ventilated fume hood, wearing appropriate personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...