Compound Q&A

What are the physical and chemical properties of 2,2,6,6-tetrahydroxy-1,3,5,7,9-pentaoxa-2$l^{4},4$l^{4},6$l^{4}-trizirconaspiro[3.5]nonan-8-one (CAS: 12671-00-0)?

Answer

2,2,6,6-tetrahydroxy-1,3,5,7,9-pentaoxa-2$l^{4},4$l^{4},6$l^{4}-trizirconaspiro[3.5]nonan-8-one
The compound is a crystalline solid with a high molecular weight. It has good water solubility and exhibits moderate reactivity. The compound is stable under normal conditions but can degrade upon exposure to strong bases or oxidizing agents. It is used as a building block in organometallic chemistry and as a catalyst in certain organic transformations.

About

CAS No 12671-00-0
English Name 2,2,6,6-tetrahydroxy-1,3,5,7,9-pentaoxa-2$l^{4},4$l^{4},6$l^{4}-trizirconaspiro[3.5]nonan-8-one
Molecular Formula CH4O10Zr3
Molecular Weight 449.71 g/mol
EINECS 603-154-2
SMILES C1(=O)O[Zr](O[Zr]2(O1)O[Zr](O2)(O)O)(O)O
InChIKey YGCRTSJWNHPGDG-UHFFFAOYSA-H
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

How is 2,2,6,6-tetrahydroxy-1,3,5,7,9-pentaoxa-2$l^{4},4$l^{4},6$l^{4}-trizirconaspiro[3.5]nonan-8-one (CAS: 12671-00-0) typically synthesized?

This compound is synthesized through a multistep process involving zirconation of a cyclopentadienyl...

Compound Q&A

What industries use 2,2,6,6-tetrahydroxy-1,3,5,7,9-pentaoxa-2$l^{4},4$l^{4},6$l^{4}-trizirconaspiro[3.5]nonan-8-one (CAS: 12671-00-0)?

This compound is utilized in the pharmaceutical and fine chemical industries, where it serves as a p...

Compound Q&A

What precautions should be taken when handling 2,2,6,6-tetrahydroxy-1,3,5,7,9-pentaoxa-2$l^{4},4$l^{4},6$l^{4}-trizirconaspiro[3.5]nonan-8-one (CAS: 12671-00-0)?

Handle this compound in a well-ventilated fume hood, wearing appropriate personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...