Compound Q&A

What precautions should be taken when handling Tris(2-methyl-2-propanyl) 1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate (CAS: 175854-39-4)?

Answer

Tris(2-methyl-2-propanyl) 1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate
When handling Tris(2-methyl-2-propanyl) 1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate, it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a dry, well-ventilated area away from incompatible materials. Spills should be handled using appropriate methods and cleaned up carefully. Always refer to the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

English Name Tris(2-methyl-2-propanyl) 1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate
Molecular Formula C23H44N4O6
Molecular Weight 472.63 g/mol
SMILES CC(C)(C)OC(=O)N1CCNCCN(CCN(CC1)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C
InChIKey ZXASHTYJQJMCQR-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tris(2-methyl-2-propanyl) 1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate (CAS: 175854-39-4)?

Tris(2-methyl-2-propanyl) 1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate is a crystalline compo...

Compound Q&A

How is Tris(2-methyl-2-propanyl) 1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate (CAS: 175854-39-4) typically synthesized?

Tris(2-methyl-2-propanyl) 1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate is synthesized through...

Compound Q&A

What industries use Tris(2-methyl-2-propanyl) 1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate (CAS: 175854-39-4)?

Tris(2-methyl-2-propanyl) 1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate is used in various ind...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...