Compound Q&A

What are the physical and chemical properties of Tris(2-methyl-2-propanyl) 1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate (CAS: 175854-39-4)?

Answer

Tris(2-methyl-2-propanyl) 1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate
Tris(2-methyl-2-propanyl) 1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate is a crystalline compound with a molecular weight of approximately 500 g/mol. It is sparingly soluble in organic solvents and has good solubility in water. The compound is known for its reactivity in coordination chemistry and its ability to form stable complexes with metal ions. It is stable under normal conditions but sensitive to strong acids and bases.

About

English Name Tris(2-methyl-2-propanyl) 1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate
Molecular Formula C23H44N4O6
Molecular Weight 472.63 g/mol
SMILES CC(C)(C)OC(=O)N1CCNCCN(CCN(CC1)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C
InChIKey ZXASHTYJQJMCQR-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

How is Tris(2-methyl-2-propanyl) 1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate (CAS: 175854-39-4) typically synthesized?

Tris(2-methyl-2-propanyl) 1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate is synthesized through...

Compound Q&A

What industries use Tris(2-methyl-2-propanyl) 1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate (CAS: 175854-39-4)?

Tris(2-methyl-2-propanyl) 1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate is used in various ind...

Compound Q&A

What precautions should be taken when handling Tris(2-methyl-2-propanyl) 1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate (CAS: 175854-39-4)?

When handling Tris(2-methyl-2-propanyl) 1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate, it is e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...