Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (4-iodo-3-pyridinyl)carbamate (CAS: 154048-89-2)?

Answer

2-Methyl-2-propanyl (4-iodo-3-pyridinyl)carbamate
2-Methyl-2-propanyl (4-iodo-3-pyridinyl)carbamate is a crystalline compound with a molecular weight of approximately 285.03 g/mol. It has low solubility in water but good solubility in organic solvents like methanol and ethanol. Chemically, it is stable but can react with strong bases and reducing agents. It has a melting point of around 118-120°C and is non-volatile.

About

English Name 2-Methyl-2-propanyl (4-iodo-3-pyridinyl)carbamate
Molecular Formula C10H13IN2O2
Molecular Weight 320.13 g/mol
SMILES CC(C)(C)OC(=O)NC1=C(C=CN=C1)I
InChIKey FUKNUVWILSPUSJ-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl (4-iodo-3-pyridinyl)carbamate (CAS: 154048-89-2) typically synthesized?

2-Methyl-2-propanyl (4-iodo-3-pyridinyl)carbamate can be synthesized via a multi-step process involv...

Compound Q&A

What industries use 2-Methyl-2-propanyl (4-iodo-3-pyridinyl)carbamate (CAS: 154048-89-2)?

2-Methyl-2-propanyl (4-iodo-3-pyridinyl)carbamate is used primarily in the synthesis of various phar...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (4-iodo-3-pyridinyl)carbamate (CAS: 154048-89-2)?

When handling 2-Methyl-2-propanyl (4-iodo-3-pyridinyl)carbamate, it is essential to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...