Compound Q&A

What precautions should be taken when handling 6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (CAS: 800402-07-7)?

Answer

6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid
When handling 6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid, it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a fume hood due to its potential volatility and reactivity. In case of spills, neutralize the spill with a suitable chemical and dispose of it according to local regulations. A Safety Data Sheet (SDS) should always be referenced for detailed handling instructions.

About

English Name 6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid
Molecular Formula C8H5ClN2O2
Molecular Weight 196.59 g/mol
SMILES C1=CC(=NC2=C1C=C(N2)C(=O)O)Cl
InChIKey MFMDNNLHOKXYLL-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (CAS: 800402-07-7)?

6-Chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid is a crystalline solid with a molecular weight ...

Compound Q&A

How is 6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (CAS: 800402-07-7) typically synthesized?

6-Chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid is typically synthesized via the chlorination o...

Compound Q&A

What industries use 6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (CAS: 800402-07-7)?

6-Chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid is used in pharmaceuticals for the synthesis of...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...