Compound Q&A

What are the physical and chemical properties of 6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (CAS: 800402-07-7)?

Answer

6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid
6-Chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid is a crystalline solid with a molecular weight of approximately 220.58 g/mol. It has limited water solubility and is slightly soluble in common organic solvents. The compound shows moderate reactivity, particularly towards nucleophiles and bases. It can form stable salts and complexes with various metal ions.

About

English Name 6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid
Molecular Formula C8H5ClN2O2
Molecular Weight 196.59 g/mol
SMILES C1=CC(=NC2=C1C=C(N2)C(=O)O)Cl
InChIKey MFMDNNLHOKXYLL-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

How is 6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (CAS: 800402-07-7) typically synthesized?

6-Chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid is typically synthesized via the chlorination o...

Compound Q&A

What industries use 6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (CAS: 800402-07-7)?

6-Chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid is used in pharmaceuticals for the synthesis of...

Compound Q&A

What precautions should be taken when handling 6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (CAS: 800402-07-7)?

When handling 6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid, it is essential to use personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...