Compound Q&A

What industries use (R)-1-Boc-2-benzylpiperazine (CAS: 947684-78-8)?

Answer

(R)-1-Boc-2-benzylpiperazine
(R)-1-Boc-2-benzylpiperazine finds applications in the pharmaceutical industry, where it serves as a precursor to various drug candidates. It is also used in the polymer industry for modifying polymers to enhance their properties. Additionally, this compound is employed in the development of sensors and semiconductors due to its unique chemical structure, which allows for specific interactions with other molecules.

About

English Name (R)-1-Boc-2-benzylpiperazine
Molecular Formula C16H24N2O2
Molecular Weight 276.38 g/mol
SMILES CC(C)(C)OC(=O)N1CCNCC1CC2=CC=CC=C2
InChIKey QKUHUJCLUFLGCI-CQSZACIVSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R)-1-Boc-2-benzylpiperazine (CAS: 947684-78-8)?

(R)-1-Boc-2-benzylpiperazine is a white crystalline solid with a molecular weight of approximately 3...

Compound Q&A

How is (R)-1-Boc-2-benzylpiperazine (CAS: 947684-78-8) typically synthesized?

(R)-1-Boc-2-benzylpiperazine is synthesized through a multistep process involving the protection of ...

Compound Q&A

What precautions should be taken when handling (R)-1-Boc-2-benzylpiperazine (CAS: 947684-78-8)?

When handling (R)-1-Boc-2-benzylpiperazine, it is essential to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...