Compound Q&A

How is (R)-1-Boc-2-benzylpiperazine (CAS: 947684-78-8) typically synthesized?

Answer

(R)-1-Boc-2-benzylpiperazine
(R)-1-Boc-2-benzylpiperazine is synthesized through a multistep process involving the protection of a piperazine ring with a Boc group and subsequent benzylation. Commonly, the synthesis begins with piperazine, which is protected with tert-butyloxycarbonyl (Boc) to form (R)-1-Boc-piperazine. This intermediate is then coupled with benzyl bromide in the presence of a catalyst like sodium hydride to produce the final compound. The overall yield is typically around 70%, with good selectivity to the (R) enantiomer.

About

English Name (R)-1-Boc-2-benzylpiperazine
Molecular Formula C16H24N2O2
Molecular Weight 276.38 g/mol
SMILES CC(C)(C)OC(=O)N1CCNCC1CC2=CC=CC=C2
InChIKey QKUHUJCLUFLGCI-CQSZACIVSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R)-1-Boc-2-benzylpiperazine (CAS: 947684-78-8)?

(R)-1-Boc-2-benzylpiperazine is a white crystalline solid with a molecular weight of approximately 3...

Compound Q&A

What industries use (R)-1-Boc-2-benzylpiperazine (CAS: 947684-78-8)?

(R)-1-Boc-2-benzylpiperazine finds applications in the pharmaceutical industry, where it serves as a...

Compound Q&A

What precautions should be taken when handling (R)-1-Boc-2-benzylpiperazine (CAS: 947684-78-8)?

When handling (R)-1-Boc-2-benzylpiperazine, it is essential to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...