Compound Q&A

What industries use Ethyl 5-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylate (CAS: 800401-62-1)?

Answer

Ethyl 5-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylate
Ethyl 5-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylate is primarily used in the pharmaceutical industry for the synthesis of medicinal compounds. It is also utilized in the development of sensors and semiconductors due to its unique chemical properties. Its applications in polymer science are limited but it has shown potential as a functional monomer for certain polymerization reactions.

About

English Name Ethyl 5-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylate
Molecular Formula C10H9ClN2O2
Molecular Weight 224.65 g/mol
SMILES CCOC(=O)C1=CC2=C(N1)C=CC(=N2)Cl
InChIKey LMNLVPXIXMUABR-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 5-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylate (CAS: 800401-62-1)?

Ethyl 5-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylate is a crystalline solid with a molecular weigh...

Compound Q&A

How is Ethyl 5-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylate (CAS: 800401-62-1) typically synthesized?

Ethyl 5-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylate can be synthesized by the condensation of eth...

Compound Q&A

What precautions should be taken when handling Ethyl 5-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylate (CAS: 800401-62-1)?

When handling Ethyl 5-chloro-1H-pyrrolo[3,2-b]pyridine-2-carboxylate, it is important to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...