Compound Q&A

What industries use (3E)-6,7-Dichloro-3-(hydroxyimino)-1,3-dihydro-2H-indol-2-one (CAS: 18711-16-5)?

Answer

(3E)-6,7-Dichloro-3-(hydroxyimino)-1,3-dihydro-2H-indol-2-one
(3E)-6,7-Dichloro-3-(hydroxyimino)-1,3-dihydro-2H-indol-2-one (CAS: 18711-16-5) is primarily used in the pharmaceutical industry for the synthesis of bioactive compounds. It also has potential applications in the polymer industry for the development of advanced materials, and in the sensor industry for the fabrication of gas sensors. Its unique chemical structure makes it a valuable reagent in various chemical processes.

About

CAS No 18711-16-5
English Name (3E)-6,7-Dichloro-3-(hydroxyimino)-1,3-dihydro-2H-indol-2-one
Molecular Formula C8H4Cl2N2O2
Molecular Weight 231.04 g/mol
SMILES C1=CC(=C(C2=C1C(=C(N2)O)N=O)Cl)Cl
InChIKey CVOUSAVHMDXCKG-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3E)-6,7-Dichloro-3-(hydroxyimino)-1,3-dihydro-2H-indol-2-one (CAS: 18711-16-5)?

(3E)-6,7-Dichloro-3-(hydroxyimino)-1,3-dihydro-2H-indol-2-one (CAS: 18711-16-5) is a crystalline com...

Compound Q&A

How is (3E)-6,7-Dichloro-3-(hydroxyimino)-1,3-dihydro-2H-indol-2-one (CAS: 18711-16-5) typically synthesized?

(3E)-6,7-Dichloro-3-(hydroxyimino)-1,3-dihydro-2H-indol-2-one (CAS: 18711-16-5) can be synthesized t...

Compound Q&A

What precautions should be taken when handling (3E)-6,7-Dichloro-3-(hydroxyimino)-1,3-dihydro-2H-indol-2-one (CAS: 18711-16-5)?

When handling (3E)-6,7-Dichloro-3-(hydroxyimino)-1,3-dihydro-2H-indol-2-one (CAS: 18711-16-5), it is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...