Compound Q&A

What are the physical and chemical properties of (3E)-6,7-Dichloro-3-(hydroxyimino)-1,3-dihydro-2H-indol-2-one (CAS: 18711-16-5)?

Answer

(3E)-6,7-Dichloro-3-(hydroxyimino)-1,3-dihydro-2H-indol-2-one
(3E)-6,7-Dichloro-3-(hydroxyimino)-1,3-dihydro-2H-indol-2-one (CAS: 18711-16-5) is a crystalline compound with a molecular weight of approximately 265.03 g/mol. It is moderately soluble in polar organic solvents but less soluble in water. This compound exhibits moderate reactivity, particularly towards nucleophiles and electrophiles. It can form complexes and has a tendency to undergo intramolecular reactions under certain conditions.

About

CAS No 18711-16-5
English Name (3E)-6,7-Dichloro-3-(hydroxyimino)-1,3-dihydro-2H-indol-2-one
Molecular Formula C8H4Cl2N2O2
Molecular Weight 231.04 g/mol
SMILES C1=CC(=C(C2=C1C(=C(N2)O)N=O)Cl)Cl
InChIKey CVOUSAVHMDXCKG-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

How is (3E)-6,7-Dichloro-3-(hydroxyimino)-1,3-dihydro-2H-indol-2-one (CAS: 18711-16-5) typically synthesized?

(3E)-6,7-Dichloro-3-(hydroxyimino)-1,3-dihydro-2H-indol-2-one (CAS: 18711-16-5) can be synthesized t...

Compound Q&A

What industries use (3E)-6,7-Dichloro-3-(hydroxyimino)-1,3-dihydro-2H-indol-2-one (CAS: 18711-16-5)?

(3E)-6,7-Dichloro-3-(hydroxyimino)-1,3-dihydro-2H-indol-2-one (CAS: 18711-16-5) is primarily used in...

Compound Q&A

What precautions should be taken when handling (3E)-6,7-Dichloro-3-(hydroxyimino)-1,3-dihydro-2H-indol-2-one (CAS: 18711-16-5)?

When handling (3E)-6,7-Dichloro-3-(hydroxyimino)-1,3-dihydro-2H-indol-2-one (CAS: 18711-16-5), it is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...