Compound Q&A

What precautions should be taken when handling 4-Hydroxymethyl-4'-methyl-2,2'-bipyridyl (CAS: 81998-04-1)?

Answer

4-Hydroxymethyl-4'-methyl-2,2'-bipyridyl
When handling 4-Hydroxymethyl-4'-methyl-2,2'-bipyridyl, wear appropriate personal protective equipment (PPE) including gloves and safety goggles. Store the compound in a closed container away from heat and direct sunlight. Use a fume hood during manipulation to avoid inhalation. In case of spill, use appropriate spill clean-up materials and wash the area with water. Refer to the Safety Data Sheet (SDS) for detailed emergency procedures and storage information.

About

CAS No 81998-04-1
English Name 4-Hydroxymethyl-4'-methyl-2,2'-bipyridyl
Molecular Formula C12H12N2O
Molecular Weight 200.24 g/mol
SMILES CC1=CC(=NC=C1)C2=NC=CC(=C2)CO
InChIKey GJCOKGHYIMLMPB-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Hydroxymethyl-4'-methyl-2,2'-bipyridyl (CAS: 81998-04-1)?

4-Hydroxymethyl-4'-methyl-2,2'-bipyridyl is a crystalline solid with a molecular weight of approxima...

Compound Q&A

How is 4-Hydroxymethyl-4'-methyl-2,2'-bipyridyl (CAS: 81998-04-1) typically synthesized?

4-Hydroxymethyl-4'-methyl-2,2'-bipyridyl is typically synthesized through a condensation reaction of...

Compound Q&A

What industries use 4-Hydroxymethyl-4'-methyl-2,2'-bipyridyl (CAS: 81998-04-1)?

4-Hydroxymethyl-4'-methyl-2,2'-bipyridyl is used in various industries, including pharmaceuticals, w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...