Compound Q&A

How is Sulfo-Cy7-acid (CAS: 943298-08-6) typically synthesized?

Answer

Sulfo-Cy7-acid
Sulfo-Cy7-acid (CAS: 943298-08-6) is synthesized through a multi-step process involving coupling reactions and derivatization. Commonly, the synthesis begins with the coupling of 7-hydroxy coumarin with a sulfuric acid derivative, followed by the introduction of the sulfonic acid group. The reaction conditions include the use of coupling reagents like EDC/NHS, with careful control over pH and temperature to ensure high yield and selectivity.

About

English Name Sulfo-Cy7-acid
Molecular Formula C35H42N2O8S2
Molecular Weight 682.85 g/mol
SMILES CCN1C2=C(C=C(C=C2)S(=O)(=O)[O-])C(C1=CC=CC=CC=CC3=[N+](C4=C(C3(C)C)C=C(C=C4)S(=O)(=O)O)CCCCCC(=O)O)(C)C
InChIKey CZWUESRDTYLNDE-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sulfo-Cy7-acid (CAS: 943298-08-6)?

Sulfo-Cy7-acid (CAS: 943298-08-6) is a water-soluble fluorescent dye with a molecular weight of appr...

Compound Q&A

What industries use Sulfo-Cy7-acid (CAS: 943298-08-6)?

Sulfo-Cy7-acid (CAS: 943298-08-6) is widely used in the pharmaceutical industry for labeling protein...

Compound Q&A

What precautions should be taken when handling Sulfo-Cy7-acid (CAS: 943298-08-6)?

When handling Sulfo-Cy7-acid (CAS: 943298-08-6), it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...