Compound Q&A

What are the physical and chemical properties of Sulfo-Cy7-acid (CAS: 943298-08-6)?

Answer

Sulfo-Cy7-acid
Sulfo-Cy7-acid (CAS: 943298-08-6) is a water-soluble fluorescent dye with a molecular weight of approximately 677.9 g/mol. It exhibits high fluorescence intensity in aqueous solutions and shows good stability under acidic and neutral conditions. The compound can form complexes with proteins and other biomolecules, making it useful for various labeling applications.

About

English Name Sulfo-Cy7-acid
Molecular Formula C35H42N2O8S2
Molecular Weight 682.85 g/mol
SMILES CCN1C2=C(C=C(C=C2)S(=O)(=O)[O-])C(C1=CC=CC=CC=CC3=[N+](C4=C(C3(C)C)C=C(C=C4)S(=O)(=O)O)CCCCCC(=O)O)(C)C
InChIKey CZWUESRDTYLNDE-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

How is Sulfo-Cy7-acid (CAS: 943298-08-6) typically synthesized?

Sulfo-Cy7-acid (CAS: 943298-08-6) is synthesized through a multi-step process involving coupling rea...

Compound Q&A

What industries use Sulfo-Cy7-acid (CAS: 943298-08-6)?

Sulfo-Cy7-acid (CAS: 943298-08-6) is widely used in the pharmaceutical industry for labeling protein...

Compound Q&A

What precautions should be taken when handling Sulfo-Cy7-acid (CAS: 943298-08-6)?

When handling Sulfo-Cy7-acid (CAS: 943298-08-6), it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...