Compound Q&A

What industries use (11beta,16alpha)-9-Fluoro-11,17-dihydroxy-3,20-dioxopregna-1,4-diene-16,21-diyl diacetate (CAS: 67-78-7)?

Answer

(11beta,16alpha)-9-Fluoro-11,17-dihydroxy-3,20-dioxopregna-1,4-diene-16,21-diyl diacetate
This compound is primarily used in the pharmaceutical industry for its hormonal properties. It can be used as an intermediate in the synthesis of certain steroid hormones. Additionally, it may find applications in research for its steroidal structure, making it relevant to the chemical and biochemical industries.

About

CAS No 67-78-7
English Name (11beta,16alpha)-9-Fluoro-11,17-dihydroxy-3,20-dioxopregna-1,4-diene-16,21-diyl diacetate
Molecular Formula C25H31FO8
Molecular Weight 478.5 g/mol
SMILES CC(=O)OCC(=O)C1(C(CC2C1(CC(C3(C2CCC4=CC(=O)C=CC43C)F)O)C)OC(=O)C)O
InChIKey XGMPVBXKDAHORN-RBWIMXSLSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of (11beta,16alpha)-9-Fluoro-11,17-dihydroxy-3,20-dioxopregna-1,4-diene-16,21-diyl diacetate (CAS: 67-78-7)?

This compound is a crystalline solid with a molecular weight of approximately 518.45 g/mol. It is sp...

Compound Q&A

How is (11beta,16alpha)-9-Fluoro-11,17-dihydroxy-3,20-dioxopregna-1,4-diene-16,21-diyl diacetate (CAS: 67-78-7) typically synthesized?

This compound is typically synthesized through a multi-step process involving the conversion of a pr...

Compound Q&A

What precautions should be taken when handling (11beta,16alpha)-9-Fluoro-11,17-dihydroxy-3,20-dioxopregna-1,4-diene-16,21-diyl diacetate (CAS: 67-78-7)?

When handling this compound, it is essential to use personal protective equipment (PPE) such as glov...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...