Compound Q&A

How is (11beta,16alpha)-9-Fluoro-11,17-dihydroxy-3,20-dioxopregna-1,4-diene-16,21-diyl diacetate (CAS: 67-78-7) typically synthesized?

Answer

(11beta,16alpha)-9-Fluoro-11,17-dihydroxy-3,20-dioxopregna-1,4-diene-16,21-diyl diacetate
This compound is typically synthesized through a multi-step process involving the conversion of a pregnane derivative to the fluoro-diol intermediate, followed by acetylation. Commonly used catalysts include sulfuric acid or trifluoromethanesulfonic acid. The overall yield is approximately 60-70%, with good selectivity towards the desired diacetate product.

About

CAS No 67-78-7
English Name (11beta,16alpha)-9-Fluoro-11,17-dihydroxy-3,20-dioxopregna-1,4-diene-16,21-diyl diacetate
Molecular Formula C25H31FO8
Molecular Weight 478.5 g/mol
SMILES CC(=O)OCC(=O)C1(C(CC2C1(CC(C3(C2CCC4=CC(=O)C=CC43C)F)O)C)OC(=O)C)O
InChIKey XGMPVBXKDAHORN-RBWIMXSLSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of (11beta,16alpha)-9-Fluoro-11,17-dihydroxy-3,20-dioxopregna-1,4-diene-16,21-diyl diacetate (CAS: 67-78-7)?

This compound is a crystalline solid with a molecular weight of approximately 518.45 g/mol. It is sp...

Compound Q&A

What industries use (11beta,16alpha)-9-Fluoro-11,17-dihydroxy-3,20-dioxopregna-1,4-diene-16,21-diyl diacetate (CAS: 67-78-7)?

This compound is primarily used in the pharmaceutical industry for its hormonal properties. It can b...

Compound Q&A

What precautions should be taken when handling (11beta,16alpha)-9-Fluoro-11,17-dihydroxy-3,20-dioxopregna-1,4-diene-16,21-diyl diacetate (CAS: 67-78-7)?

When handling this compound, it is essential to use personal protective equipment (PPE) such as glov...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...