Compound Q&A

What industries use Heptadecanedioic acid (CAS: 2424-90-0)?

Answer

Heptadecanedioic acid
Heptadecanedioic acid (CAS: 2424-90-0) is used in the pharmaceutical industry for the synthesis of certain drugs, in the polymer industry for creating functionalized polymers, and in the sensor and semiconductor industries for its acidic properties and reactivity.

About

CAS No 2424-90-0
English Name Heptadecanedioic acid
Molecular Formula C17H32O4
Molecular Weight 300.44 g/mol
SMILES C(CCCCCCCC(=O)O)CCCCCCCC(=O)O
InChIKey QCNWZROVPSVEJA-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of Heptadecanedioic acid (CAS: 2424-90-0)?

Heptadecanedioic acid (CAS: 2424-90-0) is a white crystalline solid with a molecular weight of appro...

Compound Q&A

How is Heptadecanedioic acid (CAS: 2424-90-0) typically synthesized?

Heptadecanedioic acid (CAS: 2424-90-0) is typically synthesized through the dehydration of 17-hydrox...

Compound Q&A

What precautions should be taken when handling Heptadecanedioic acid (CAS: 2424-90-0)?

When handling Heptadecanedioic acid (CAS: 2424-90-0), it is important to use appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...