Compound Q&A

What are the physical and chemical properties of Heptadecanedioic acid (CAS: 2424-90-0)?

Answer

Heptadecanedioic acid
Heptadecanedioic acid (CAS: 2424-90-0) is a white crystalline solid with a molecular weight of approximately 306.39 g/mol. It has a solubility of up to 0.5 g/L in water. Chemically, it is moderately reactive and can form esters and amides. It is used in various applications where its acidic properties are beneficial.

About

CAS No 2424-90-0
English Name Heptadecanedioic acid
Molecular Formula C17H32O4
Molecular Weight 300.44 g/mol
SMILES C(CCCCCCCC(=O)O)CCCCCCCC(=O)O
InChIKey QCNWZROVPSVEJA-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

How is Heptadecanedioic acid (CAS: 2424-90-0) typically synthesized?

Heptadecanedioic acid (CAS: 2424-90-0) is typically synthesized through the dehydration of 17-hydrox...

Compound Q&A

What industries use Heptadecanedioic acid (CAS: 2424-90-0)?

Heptadecanedioic acid (CAS: 2424-90-0) is used in the pharmaceutical industry for the synthesis of c...

Compound Q&A

What precautions should be taken when handling Heptadecanedioic acid (CAS: 2424-90-0)?

When handling Heptadecanedioic acid (CAS: 2424-90-0), it is important to use appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...