Compound Q&A

How should 6-Fluoro-1H-indole-2-carboxylic acid (CAS: 3093-97-8) be stored?

Answer

6-Fluoro-1H-indole-2-carboxylic acid
6-Fluoro-1H-indole-2-carboxylic acid (CAS: 3093-97-8) should be stored in a cool, dry place away from direct sunlight and heat sources. It is advisable to store the compound in a tightly sealed container to prevent moisture and light exposure. Maintain a temperature range between 15-25°C and a relative humidity below 50% to ensure optimal storage conditions.

About

CAS No 3093-97-8
English Name 6-Fluoro-1H-indole-2-carboxylic acid
Molecular Formula C9H6FNO2
Molecular Weight 179.15 g/mol
SMILES C1=CC2=C(C=C1F)NC(=C2)C(=O)O
InChIKey LRTIKMXIKAOCDM-UHFFFAOYSA-N
Last Updated: 2025-10-24 20:48

Related Q&A

Compound Q&A

What is 6-Fluoro-1H-indole-2-carboxylic acid (CAS: 3093-97-8)?

6-Fluoro-1H-indole-2-carboxylic acid (CAS: 3093-97-8) is a chemical compound with the molecular form...

Compound Q&A

What are the main uses of 6-Fluoro-1H-indole-2-carboxylic acid (CAS: 3093-97-8)?

6-Fluoro-1H-indole-2-carboxylic acid (CAS: 3093-97-8) is primarily used in the pharmaceutical indust...

Compound Q&A

Is 6-Fluoro-1H-indole-2-carboxylic acid (CAS: 3093-97-8) safe?

6-Fluoro-1H-indole-2-carboxylic acid (CAS: 3093-97-8) is generally safe when handled with appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...