Compound Q&A

What are the main uses of 6-Fluoro-1H-indole-2-carboxylic acid (CAS: 3093-97-8)?

Answer

6-Fluoro-1H-indole-2-carboxylic acid
6-Fluoro-1H-indole-2-carboxylic acid (CAS: 3093-97-8) is primarily used in the pharmaceutical industry for the synthesis of various bioactive compounds. It also finds applications in research for studying the properties of indole derivatives and in organic synthesis as a building block for other organic compounds.

About

CAS No 3093-97-8
English Name 6-Fluoro-1H-indole-2-carboxylic acid
Molecular Formula C9H6FNO2
Molecular Weight 179.15 g/mol
SMILES C1=CC2=C(C=C1F)NC(=C2)C(=O)O
InChIKey LRTIKMXIKAOCDM-UHFFFAOYSA-N
Last Updated: 2025-10-24 20:48

Related Q&A

Compound Q&A

What is 6-Fluoro-1H-indole-2-carboxylic acid (CAS: 3093-97-8)?

6-Fluoro-1H-indole-2-carboxylic acid (CAS: 3093-97-8) is a chemical compound with the molecular form...

Compound Q&A

Is 6-Fluoro-1H-indole-2-carboxylic acid (CAS: 3093-97-8) safe?

6-Fluoro-1H-indole-2-carboxylic acid (CAS: 3093-97-8) is generally safe when handled with appropriat...

Compound Q&A

How should 6-Fluoro-1H-indole-2-carboxylic acid (CAS: 3093-97-8) be stored?

6-Fluoro-1H-indole-2-carboxylic acid (CAS: 3093-97-8) should be stored in a cool, dry place away fro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...