Compound Q&A

Is N-Benzyl-N,N-dipropyl-1-propanaminium chloride (CAS: 5197-87-5) safe?

Answer

N-Benzyl-N,N-dipropyl-1-propanaminium chloride
N-Benzyl-N,N-dipropyl-1-propanaminium chloride is generally considered safe when used as directed. However, it should be handled with caution due to its irritant properties. Protective gloves and eyewear should be worn during handling, and it should be kept away from skin and eyes. Inhalation should be avoided, and appropriate ventilation is recommended.

About

CAS No 5197-87-5
English Name N-Benzyl-N,N-dipropyl-1-propanaminium chloride
Molecular Formula C16H28ClN
Molecular Weight 269.9 g/mol
SMILES CCC[N+](CCC)(CCC)CC1=CC=CC=C1.[Cl-]
InChIKey YTRIOKYQEVFKGU-UHFFFAOYSA-M
Last Updated: 2025-10-24 11:59

Related Q&A

Compound Q&A

What is N-Benzyl-N,N-dipropyl-1-propanaminium chloride (CAS: 5197-87-5)?

N-Benzyl-N,N-dipropyl-1-propanaminium chloride is a chemical compound with the CAS number 5197-87-5....

Compound Q&A

What are the main uses of N-Benzyl-N,N-dipropyl-1-propanaminium chloride (CAS: 5197-87-5)?

N-Benzyl-N,N-dipropyl-1-propanaminium chloride is primarily used as a fungicide in agriculture, a pr...

Compound Q&A

How should N-Benzyl-N,N-dipropyl-1-propanaminium chloride (CAS: 5197-87-5) be stored?

N-Benzyl-N,N-dipropyl-1-propanaminium chloride should be stored in a cool, dry place away from direc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...