Compound Q&A

What is N-Benzyl-N,N-dipropyl-1-propanaminium chloride (CAS: 5197-87-5)?

Answer

N-Benzyl-N,N-dipropyl-1-propanaminium chloride
N-Benzyl-N,N-dipropyl-1-propanaminium chloride is a chemical compound with the CAS number 5197-87-5. It is an amine salt with a molecular structure that includes a benzyl group and three propyl groups. The compound is soluble in water and has a pungent odor.

About

CAS No 5197-87-5
English Name N-Benzyl-N,N-dipropyl-1-propanaminium chloride
Molecular Formula C16H28ClN
Molecular Weight 269.9 g/mol
SMILES CCC[N+](CCC)(CCC)CC1=CC=CC=C1.[Cl-]
InChIKey YTRIOKYQEVFKGU-UHFFFAOYSA-M
Last Updated: 2025-10-24 11:59

Related Q&A

Compound Q&A

What are the main uses of N-Benzyl-N,N-dipropyl-1-propanaminium chloride (CAS: 5197-87-5)?

N-Benzyl-N,N-dipropyl-1-propanaminium chloride is primarily used as a fungicide in agriculture, a pr...

Compound Q&A

Is N-Benzyl-N,N-dipropyl-1-propanaminium chloride (CAS: 5197-87-5) safe?

N-Benzyl-N,N-dipropyl-1-propanaminium chloride is generally considered safe when used as directed. H...

Compound Q&A

How should N-Benzyl-N,N-dipropyl-1-propanaminium chloride (CAS: 5197-87-5) be stored?

N-Benzyl-N,N-dipropyl-1-propanaminium chloride should be stored in a cool, dry place away from direc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...