Compound Q&A

Is (3R,4S,5S,6R)-2-(4-chloro-3-(4-(((S)-tetrahydrofuran-3-yl)oxy)benzyl)phenyl)-6-(hydroxyMethyl)tetrahydro-2H-pyran-2,3,4,5-tetraol (CAS: 1620758-34-0) safe?

Answer

(3R,4S,5S,6R)-2-(4-chloro-3-(4-(((S)-tetrahydrofuran-3-yl)oxy)benzyl)phenyl)-6-(hydroxyMethyl)tetrahydro-2H-pyran-2,3,4,5-tetraol
The safety of this compound depends on the specific context of its use. It should be handled with appropriate safety precautions, such as using gloves, goggles, and protective clothing. Proper ventilation is essential during handling. It is not considered hazardous under normal storage conditions, but care should be taken to avoid ingestion, inhalation, or contact with eyes and skin.

About

English Name (3R,4S,5S,6R)-2-(4-chloro-3-(4-(((S)-tetrahydrofuran-3-yl)oxy)benzyl)phenyl)-6-(hydroxyMethyl)tetrahydro-2H-pyran-2,3,4,5-tetraol
Molecular Formula C23H29ClO8
Molecular Weight 468.92 g/mol
SMILES OCC(C(C(C(C(c1ccc(c(c1)Cc1ccc(cc1)OC1COCC1)Cl)O)O)O)O)O
InChIKey RKDDAJYLEWTGMU-UHFFFAOYSA-N
Last Updated: 2025-10-24 11:59

Related Q&A

Compound Q&A

What is (3R,4S,5S,6R)-2-(4-chloro-3-(4-(((S)-tetrahydrofuran-3-yl)oxy)benzyl)phenyl)-6-(hydroxyMethyl)tetrahydro-2H-pyran-2,3,4,5-tetraol (CAS: 1620758-34-0)?

This compound is a complex organic molecule with a specific stereochemistry and functional groups. I...

Compound Q&A

How should (3R,4S,5S,6R)-2-(4-chloro-3-(4-(((S)-tetrahydrofuran-3-yl)oxy)benzyl)phenyl)-6-(hydroxyMethyl)tetrahydro-2H-pyran-2,3,4,5-tetraol (CAS: 1620758-34-0) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...