Compound Q&A

What are the main uses of (3R,4S,5S,6R)-2-(4-chloro-3-(4-(((S)-tetrahydrofuran-3-yl)oxy)benzyl)phenyl)-6-(hydroxyMethyl)tetrahydro-2H-pyran-2,3,4,5-tetraol (CAS: 1620758-34-0)?

Answer

(3R,4S,5S,6R)-2-(4-chloro-3-(4-(((S)-tetrahydrofuran-3-yl)oxy)benzyl)phenyl)-6-(hydroxyMethyl)tetrahydro-2H-pyran-2,3,4,5-tetraol
This compound is primarily used in the pharmaceutical industry for developing new drug candidates. It is also utilized in research for its unique molecular structure and reactivity. In the chemical industry, it serves as a precursor in synthesis processes due to its specific functional groups.

About

English Name (3R,4S,5S,6R)-2-(4-chloro-3-(4-(((S)-tetrahydrofuran-3-yl)oxy)benzyl)phenyl)-6-(hydroxyMethyl)tetrahydro-2H-pyran-2,3,4,5-tetraol
Molecular Formula C23H29ClO8
Molecular Weight 468.92 g/mol
SMILES OCC(C(C(C(C(c1ccc(c(c1)Cc1ccc(cc1)OC1COCC1)Cl)O)O)O)O)O
InChIKey RKDDAJYLEWTGMU-UHFFFAOYSA-N
Last Updated: 2025-10-24 11:59

Related Q&A

Compound Q&A

What is (3R,4S,5S,6R)-2-(4-chloro-3-(4-(((S)-tetrahydrofuran-3-yl)oxy)benzyl)phenyl)-6-(hydroxyMethyl)tetrahydro-2H-pyran-2,3,4,5-tetraol (CAS: 1620758-34-0)?

This compound is a complex organic molecule with a specific stereochemistry and functional groups. I...

Compound Q&A

Is (3R,4S,5S,6R)-2-(4-chloro-3-(4-(((S)-tetrahydrofuran-3-yl)oxy)benzyl)phenyl)-6-(hydroxyMethyl)tetrahydro-2H-pyran-2,3,4,5-tetraol (CAS: 1620758-34-0) safe?

The safety of this compound depends on the specific context of its use. It should be handled with ap...

Compound Q&A

How should (3R,4S,5S,6R)-2-(4-chloro-3-(4-(((S)-tetrahydrofuran-3-yl)oxy)benzyl)phenyl)-6-(hydroxyMethyl)tetrahydro-2H-pyran-2,3,4,5-tetraol (CAS: 1620758-34-0) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...