Compound Q&A

How should waste containing (2R)-4-[(Benzyloxy)carbonyl]-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid (CAS: 138775-02-7) be handled?

Answer

(2R)-4-[(Benzyloxy)carbonyl]-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid
Waste containing this compound should be collected and disposed of according to local regulations. It is advisable to incinerate the waste at a licensed facility to ensure complete destruction. Environmental protection precautions include proper containment during collection and transportation to prevent spillage. Additionally, the waste should be minimized through efficient use and recycling, where applicable, to reduce overall environmental impact.

About

English Name (2R)-4-[(Benzyloxy)carbonyl]-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid
Molecular Formula C18H24N2O6
Molecular Weight 364.4 g/mol
SMILES CC(C)(C)OC(=O)N1CCN(C[C@@H]1C(=O)O)C(=O)OCC2=CC=CC=C2
InChIKey SREPAMKILVVDSP-CQSZACIVSA-N
Last Updated: 2025-10-23 17:36

Related Q&A

Compound Q&A

What regulatory guidelines apply to (2R)-4-[(Benzyloxy)carbonyl]-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid (CAS: 138775-02-7)?

The compound must comply with the REACH regulations in the European Union, ensuring that manufacture...

Compound Q&A

Are there alternatives to (2R)-4-[(Benzyloxy)carbonyl]-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid (CAS: 138775-02-7) in synthesis?

There are alternative reagents, such as (2S)-4-[(Benzyloxy)carbonyl]-1-{[(2-methyl-2-propanyl)oxy]ca...

Compound Q&A

What is the market or research trend for (2R)-4-[(Benzyloxy)carbonyl]-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid (CAS: 138775-02-7)?

There is a growing interest in the compound for its potential in drug discovery and development, par...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...