Compound Q&A

Are there alternatives to Diethyl dibromomalonate (CAS: 631-22-1) in synthesis?

Answer

Diethyl dibromomalonate
There are alternative reagents that can be used in synthesis depending on the specific application. For example, ethyl dibromomalonate or other dibromo malonate derivatives might be used as alternatives. Additionally, synthetic pathways using different functional groups such as bromoacetic acid or bromoform can be explored. The choice of alternative reagents depends on the desired product properties and the reaction conditions.

About

CAS No 631-22-1
English Name Diethyl dibromomalonate
Molecular Formula C7H10Br2O4
Molecular Weight 317.96 g/mol
SMILES CCOC(=O)C(C(=O)OCC)(Br)Br
InChIKey PFZYFZRUPFUEOB-UHFFFAOYSA-N
Last Updated: 2025-10-23 12:19

Related Q&A

Compound Q&A

What regulatory guidelines apply to Diethyl dibromomalonate (CAS: 631-22-1)?

Diethyl dibromomalonate (CAS: 631-22-1) falls under the classification of chemicals with potential h...

Compound Q&A

What is the market or research trend for Diethyl dibromomalonate (CAS: 631-22-1)?

The market for Diethyl dibromomalonate (CAS: 631-22-1) is primarily driven by its use in the synthes...

Compound Q&A

How should waste containing Diethyl dibromomalonate (CAS: 631-22-1) be handled?

Waste containing Diethyl dibromomalonate (CAS: 631-22-1) should be collected in appropriate, labeled...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...