Compound Q&A

What is the market or research trend for 2-Chloro-5-nitrobenzenesulfonyl chloride (CAS: 4533-95-3)?

Answer

2-Chloro-5-nitrobenzenesulfonyl chloride
The market for 2-Chloro-5-nitrobenzenesulfonyl chloride (CAS: 4533-95-3) is trending towards increased use in the development of pharmaceuticals and agrochemicals due to its reactivity. Research is focusing on its role in synthesizing complex organic molecules and its potential in tailored drug delivery systems. Additionally, there is a growing emphasis on sustainable synthesis methods and eco-friendly alternatives.

About

CAS No 4533-95-3
English Name 2-Chloro-5-nitrobenzenesulfonyl chloride
Molecular Formula C6H3Cl2NO4S
Molecular Weight 256.0633 g/mol
SMILES [O-][N+](=O)c1ccc(Cl)c(c1)S(=O)(=O)Cl
InChIKey COZWQPZDKVIVFS-UHFFFAOYSA-N
Last Updated: 2025-10-23 12:19

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2-Chloro-5-nitrobenzenesulfonyl chloride (CAS: 4533-95-3)?

2-Chloro-5-nitrobenzenesulfonyl chloride (CAS: 4533-95-3) falls under the GHS classification as a ha...

Compound Q&A

Are there alternatives to 2-Chloro-5-nitrobenzenesulfonyl chloride in synthesis?

Alternatives to 2-Chloro-5-nitrobenzenesulfonyl chloride (CAS: 4533-95-3) in synthesis include other...

Compound Q&A

How should waste containing 2-Chloro-5-nitrobenzenesulfonyl chloride (CAS: 4533-95-3) be handled?

Waste containing 2-Chloro-5-nitrobenzenesulfonyl chloride (CAS: 4533-95-3) should be collected in ap...

Compound Q&A

What are the main uses of 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile (CAS: 70291-62-2)?

2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile is primarily used a...

70291-62-22-Amino-5,6-dihydro-...
Compound Q&A

What industries use Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7)?

Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7) is primarily used in th...

941306-58-7Methyl 5-ethoxy-2-py...
Compound Q&A

How is 4-Butyl-4'-hydroxychalcone (CAS: 385810-21-9) typically synthesized?

4-Butyl-4'-hydroxychalcone is commonly synthesized via a condensation reaction o...

385810-21-94-Butyl-4'-hydroxych...
Compound Q&A

What is 8-Bromo-4-methylquinoline (CAS: 172939-50-3)?

8-Bromo-4-methylquinoline is a chemical compound with the CAS number 172939-50-3...

172939-50-38-Bromo-4-methylquin...