Compound Q&A

Are there alternatives to 2-Chloro-5-nitrobenzenesulfonyl chloride in synthesis?

Answer

2-Chloro-5-nitrobenzenesulfonyl chloride
Alternatives to 2-Chloro-5-nitrobenzenesulfonyl chloride (CAS: 4533-95-3) in synthesis include other sulfonyl chlorides like 2-Nitrobenzenesulfonyl chloride or 5-Chloro-2-nitrobenzenesulfonyl chloride. These can be used as substitutes depending on the specific reaction conditions and desired product structure.

About

CAS No 4533-95-3
English Name 2-Chloro-5-nitrobenzenesulfonyl chloride
Molecular Formula C6H3Cl2NO4S
Molecular Weight 256.0633 g/mol
SMILES [O-][N+](=O)c1ccc(Cl)c(c1)S(=O)(=O)Cl
InChIKey COZWQPZDKVIVFS-UHFFFAOYSA-N
Last Updated: 2025-10-23 12:19

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2-Chloro-5-nitrobenzenesulfonyl chloride (CAS: 4533-95-3)?

2-Chloro-5-nitrobenzenesulfonyl chloride (CAS: 4533-95-3) falls under the GHS classification as a ha...

Compound Q&A

What is the market or research trend for 2-Chloro-5-nitrobenzenesulfonyl chloride (CAS: 4533-95-3)?

The market for 2-Chloro-5-nitrobenzenesulfonyl chloride (CAS: 4533-95-3) is trending towards increas...

Compound Q&A

How should waste containing 2-Chloro-5-nitrobenzenesulfonyl chloride (CAS: 4533-95-3) be handled?

Waste containing 2-Chloro-5-nitrobenzenesulfonyl chloride (CAS: 4533-95-3) should be collected in ap...

Compound Q&A

What are the main uses of 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile (CAS: 70291-62-2)?

2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile is primarily used a...

70291-62-22-Amino-5,6-dihydro-...
Compound Q&A

What industries use Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7)?

Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7) is primarily used in th...

941306-58-7Methyl 5-ethoxy-2-py...
Compound Q&A

How is 4-Butyl-4'-hydroxychalcone (CAS: 385810-21-9) typically synthesized?

4-Butyl-4'-hydroxychalcone is commonly synthesized via a condensation reaction o...

385810-21-94-Butyl-4'-hydroxych...
Compound Q&A

What is 8-Bromo-4-methylquinoline (CAS: 172939-50-3)?

8-Bromo-4-methylquinoline is a chemical compound with the CAS number 172939-50-3...

172939-50-38-Bromo-4-methylquin...