Compound Q&A

What industries use 4-(1,3-Oxazol-5-yl)benzonitrile (CAS: 87150-13-8)?

Answer

4-(1,3-Oxazol-5-yl)benzonitrile
4-(1,3-Oxazol-5-yl)benzonitrile (CAS: 87150-13-8) is primarily used in the pharmaceutical industry for its potential in drug synthesis and as a building block for medicinal chemistry. It also finds applications in the polymer industry for the development of new materials and in the semiconductor industry for the fabrication of electronic devices. Additionally, it is used in sensor technology for detecting specific chemicals and in research for various analytical purposes.

About

CAS No 87150-13-8
English Name 4-(1,3-Oxazol-5-yl)benzonitrile
Molecular Formula C10H6N2O
Molecular Weight 17.03 g/mol
SMILES N#CC1=CC=C(C2=CN=CO2)C=C1
InChIKey LZMCNLOQTURTHS-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(1,3-Oxazol-5-yl)benzonitrile (CAS: 87150-13-8)?

4-(1,3-Oxazol-5-yl)benzonitrile (CAS: 87150-13-8) is a white crystalline solid with a molecular weig...

Compound Q&A

How is 4-(1,3-Oxazol-5-yl)benzonitrile (CAS: 87150-13-8) typically synthesized?

4-(1,3-Oxazol-5-yl)benzonitrile (CAS: 87150-13-8) is typically synthesized via the condensation of 5...

Compound Q&A

What precautions should be taken when handling 4-(1,3-Oxazol-5-yl)benzonitrile (CAS: 87150-13-8)?

When handling 4-(1,3-Oxazol-5-yl)benzonitrile (CAS: 87150-13-8), it is important to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...