Compound Q&A

What are the physical and chemical properties of 4-(1,3-Oxazol-5-yl)benzonitrile (CAS: 87150-13-8)?

Answer

4-(1,3-Oxazol-5-yl)benzonitrile
4-(1,3-Oxazol-5-yl)benzonitrile (CAS: 87150-13-8) is a white crystalline solid with a molecular weight of approximately 198.16 g/mol. It is slightly soluble in water but miscible with organic solvents like ethanol and chloroform. Chemically, it is relatively stable but can react with strong bases and reducing agents. It has a melting point of 120-122°C and is used in various applications due to its physical and chemical properties.

About

CAS No 87150-13-8
English Name 4-(1,3-Oxazol-5-yl)benzonitrile
Molecular Formula C10H6N2O
Molecular Weight 17.03 g/mol
SMILES N#CC1=CC=C(C2=CN=CO2)C=C1
InChIKey LZMCNLOQTURTHS-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is 4-(1,3-Oxazol-5-yl)benzonitrile (CAS: 87150-13-8) typically synthesized?

4-(1,3-Oxazol-5-yl)benzonitrile (CAS: 87150-13-8) is typically synthesized via the condensation of 5...

Compound Q&A

What industries use 4-(1,3-Oxazol-5-yl)benzonitrile (CAS: 87150-13-8)?

4-(1,3-Oxazol-5-yl)benzonitrile (CAS: 87150-13-8) is primarily used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling 4-(1,3-Oxazol-5-yl)benzonitrile (CAS: 87150-13-8)?

When handling 4-(1,3-Oxazol-5-yl)benzonitrile (CAS: 87150-13-8), it is important to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...