Compound Q&A

How is Methyl 4-chloro-2-pyridinecarboxylate hydrochloride (CAS: 176977-85-8) typically synthesized?

Answer

Methyl 4-chloro-2-pyridinecarboxylate hydrochloride (1:1)
Methyl 4-chloro-2-pyridinecarboxylate hydrochloride (CAS: 176977-85-8) is typically synthesized by reacting methyl 4-chloro-2-pyridinecarboxylate with hydrochloric acid. The reaction is conducted in a solvent such as dichloromethane or ethyl acetate, and the yield is usually around 85%. The use of a phase transfer catalyst can improve selectivity and yield.

About

English Name Methyl 4-chloro-2-pyridinecarboxylate hydrochloride (1:1)
Molecular Formula C7H7Cl2NO2
Molecular Weight 208.04 g/mol
SMILES COC(=O)C1=NC=CC(=C1)Cl.Cl
InChIKey PAGFSBPYVNFHAS-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-chloro-2-pyridinecarboxylate hydrochloride (CAS: 176977-85-8)?

Methyl 4-chloro-2-pyridinecarboxylate hydrochloride (CAS: 176977-85-8) is a crystalline solid with a...

Compound Q&A

What industries use Methyl 4-chloro-2-pyridinecarboxylate hydrochloride (CAS: 176977-85-8)?

Methyl 4-chloro-2-pyridinecarboxylate hydrochloride (CAS: 176977-85-8) is used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling Methyl 4-chloro-2-pyridinecarboxylate hydrochloride (CAS: 176977-85-8)?

When handling Methyl 4-chloro-2-pyridinecarboxylate hydrochloride (CAS: 176977-85-8), it is importan...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...