Compound Q&A

What precautions should be taken when handling Hsp-990 (CAS: 934343-74-5)?

Answer

Hsp-990
When handling Hsp-990 (CAS: 934343-74-5), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be stored in a cool, dry place away from direct sunlight and potential sources of heat. Spills should be cleaned up using appropriate absorbents and disposed of according to local regulations. Always consult the Safety Data Sheet (SDS) for detailed handling and disposal information.

About

English Name Hsp-990
Molecular Formula C20H18FN5O2
Molecular Weight 379.4 g/mol
SMILES CC1=C2C(=NC(=N1)N)CC(NC2=O)C3=C(C=C(C=C3)F)C4=NC(=CC=C4)OC
InChIKey WSMQUUGTQYPVPD-OAHLLOKOSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Hsp-990 (CAS: 934343-74-5)?

Hsp-990 (CAS: 934343-74-5) is a crystalline compound with a molecular weight of approximately 1034.6...

Compound Q&A

How is Hsp-990 (CAS: 934343-74-5) typically synthesized?

Hsp-990 (CAS: 934343-74-5) is synthesized via a multi-step process involving condensation reactions,...

Compound Q&A

What industries use Hsp-990 (CAS: 934343-74-5)?

Hsp-990 (CAS: 934343-74-5) is primarily used in pharmaceutical research due to its potential as an H...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...