Compound Q&A

What are the physical and chemical properties of Hsp-990 (CAS: 934343-74-5)?

Answer

Hsp-990
Hsp-990 (CAS: 934343-74-5) is a crystalline compound with a molecular weight of approximately 1034.6 g/mol. It is sparingly soluble in water and ethanol, and soluble in dimethyl sulfoxide (DMSO). Hsp-990 is stable under normal laboratory conditions but can degrade under strong acidic or basic conditions. It does not react with common reagents such as hydroxides or halides at room temperature.

About

English Name Hsp-990
Molecular Formula C20H18FN5O2
Molecular Weight 379.4 g/mol
SMILES CC1=C2C(=NC(=N1)N)CC(NC2=O)C3=C(C=C(C=C3)F)C4=NC(=CC=C4)OC
InChIKey WSMQUUGTQYPVPD-OAHLLOKOSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is Hsp-990 (CAS: 934343-74-5) typically synthesized?

Hsp-990 (CAS: 934343-74-5) is synthesized via a multi-step process involving condensation reactions,...

Compound Q&A

What industries use Hsp-990 (CAS: 934343-74-5)?

Hsp-990 (CAS: 934343-74-5) is primarily used in pharmaceutical research due to its potential as an H...

Compound Q&A

What precautions should be taken when handling Hsp-990 (CAS: 934343-74-5)?

When handling Hsp-990 (CAS: 934343-74-5), it is essential to wear appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...