Compound Q&A

What are the physical and chemical properties of (1S,3aR,4S,6aR)-1-(3,4-Dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan (CAS: 41689-51-4)?

Answer

(1S,3aR,4S,6aR)-1-(3,4-Dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan
The compound (1S,3aR,4S,6aR)-1-(3,4-Dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan has a molecular weight of approximately 480.45 g/mol and a crystalline form. It is poorly soluble in water but soluble in common organic solvents like ethanol and dichloromethane. Chemically, it is relatively stable but may react with strong acids or bases. It has a low reactivity under normal conditions but can undergo ring-opening reactions under specific conditions.

About

CAS No 41689-51-4
English Name (1S,3aR,4S,6aR)-1-(3,4-Dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan
Molecular Formula C23H28O7
Molecular Weight 416.47 g/mol
SMILES COC1=CC(=CC(OC)=C1OC)[C@H]1OCC2C1CO[C@@H]2C1=CC(OC)=C(OC)C=C1
InChIKey MFIHSKBTNZNJIK-RZTYQLBFSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is (1S,3aR,4S,6aR)-1-(3,4-Dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan (CAS: 41689-51-4) typically synthesized?

This compound can be synthesized via a multistep process involving the coupling of a 3,4-dimethoxyph...

Compound Q&A

What industries use (1S,3aR,4S,6aR)-1-(3,4-Dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan (CAS: 41689-51-4)?

This compound is used in various industries, primarily in the pharmaceutical sector for drug develop...

Compound Q&A

What precautions should be taken when handling (1S,3aR,4S,6aR)-1-(3,4-Dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan (CAS: 41689-51-4)?

When handling this compound, it is essential to use appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...