Compound Q&A

What industries use 1-Ethyl-3-methyl-1H-imidazol-3-ium methyl sulfate (CAS: 516474-01-4)?

Answer

1-Ethyl-3-methyl-1H-imidazol-3-ium methyl sulfate
1-Ethyl-3-methyl-1H-imidazol-3-ium methyl sulfate finds applications in the pharmaceutical industry for its use as a proton conductor in solid acid catalysts. It is also used in the polymer industry as a component in ionomers and in the development of sensors and semiconductors for its unique ionic conductive properties.

About

English Name 1-Ethyl-3-methyl-1H-imidazol-3-ium methyl sulfate
Molecular Formula C7H14N2O4S
Molecular Weight 222.26 g/mol
SMILES COS([O-])(=O)=O.CC[N+]1=CN(C)C=C1
InChIKey BXSDLSWVIAITRQ-UHFFFAOYSA-M
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Ethyl-3-methyl-1H-imidazol-3-ium methyl sulfate (CAS: 516474-01-4)?

1-Ethyl-3-methyl-1H-imidazol-3-ium methyl sulfate is a white crystalline solid. Its molecular weight...

Compound Q&A

How is 1-Ethyl-3-methyl-1H-imidazol-3-ium methyl sulfate (CAS: 516474-01-4) typically synthesized?

1-Ethyl-3-methyl-1H-imidazol-3-ium methyl sulfate is synthesized by treating 1-ethyl-3-methylimidazo...

Compound Q&A

What precautions should be taken when handling 1-Ethyl-3-methyl-1H-imidazol-3-ium methyl sulfate (CAS: 516474-01-4)?

When handling 1-Ethyl-3-methyl-1H-imidazol-3-ium methyl sulfate, appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...