Compound Q&A

What are the physical and chemical properties of 1-Ethyl-3-methyl-1H-imidazol-3-ium methyl sulfate (CAS: 516474-01-4)?

Answer

1-Ethyl-3-methyl-1H-imidazol-3-ium methyl sulfate
1-Ethyl-3-methyl-1H-imidazol-3-ium methyl sulfate is a white crystalline solid. Its molecular weight is approximately 206.28 g/mol. It is sparingly soluble in water and organic solvents. The compound is moderately reactive, particularly towards bases and reducing agents. It is stable under normal conditions but should be stored away from strong acids and oxidizers.

About

English Name 1-Ethyl-3-methyl-1H-imidazol-3-ium methyl sulfate
Molecular Formula C7H14N2O4S
Molecular Weight 222.26 g/mol
SMILES COS([O-])(=O)=O.CC[N+]1=CN(C)C=C1
InChIKey BXSDLSWVIAITRQ-UHFFFAOYSA-M
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is 1-Ethyl-3-methyl-1H-imidazol-3-ium methyl sulfate (CAS: 516474-01-4) typically synthesized?

1-Ethyl-3-methyl-1H-imidazol-3-ium methyl sulfate is synthesized by treating 1-ethyl-3-methylimidazo...

Compound Q&A

What industries use 1-Ethyl-3-methyl-1H-imidazol-3-ium methyl sulfate (CAS: 516474-01-4)?

1-Ethyl-3-methyl-1H-imidazol-3-ium methyl sulfate finds applications in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling 1-Ethyl-3-methyl-1H-imidazol-3-ium methyl sulfate (CAS: 516474-01-4)?

When handling 1-Ethyl-3-methyl-1H-imidazol-3-ium methyl sulfate, appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...