Compound Q&A

How is 6-Fluoroquinazoline-2,4-diol (CAS: 88145-90-8) typically synthesized?

Answer

6-Fluoroquinazoline-2,4-diol
6-Fluoroquinazoline-2,4-diol is typically synthesized via a multi-step reaction involving the conversion of a starting amine to an amide, followed by the introduction of a fluoro group, and finally the reduction of an intermediate aldehyde to obtain the diol. Catalysts like palladium are often used to enhance the selectivity and yield of the reactions.

About

CAS No 88145-90-8
English Name 6-Fluoroquinazoline-2,4-diol
Molecular Formula C8H5FN2O2
Molecular Weight 180.14 g/mol
SMILES C1=CC2=C(C=C1F)C(=O)NC(=O)N2
InChIKey QUQJMNPJMVUMNE-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Fluoroquinazoline-2,4-diol (CAS: 88145-90-8)?

6-Fluoroquinazoline-2,4-diol is a solid with a melting point of 214-216°C. It has a molecular weight...

Compound Q&A

What industries use 6-Fluoroquinazoline-2,4-diol (CAS: 88145-90-8)?

6-Fluoroquinazoline-2,4-diol is primarily used in the pharmaceutical industry for the development of...

Compound Q&A

What precautions should be taken when handling 6-Fluoroquinazoline-2,4-diol (CAS: 88145-90-8)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...