Compound Q&A

How is tert-Butyl ((1S,3S)-3-aminocyclopentyl)carbamate (CAS: 645400-44-8) typically synthesized?

Answer

tert-Butyl ((1S,3S)-3-aminocyclopentyl)carbamate
tert-Butyl ((1S,3S)-3-aminocyclopentyl)carbamate is typically synthesized via a multistep process, starting from cyclopentanone and primary amines. The reaction involves the reduction of cyclopentanone to cyclopentanol, followed by the nucleophilic substitution of the carbonyl group with tert-butyl isocyanate. This process requires mild conditions and can be catalyzed by tertiary amines to improve selectivity and yield.

About

English Name tert-Butyl ((1S,3S)-3-aminocyclopentyl)carbamate
Molecular Formula C10H20N2O2
Molecular Weight 200.28 g/mol
SMILES CC(C)(C)OC(=O)NC1CCC(C1)N
InChIKey PGBVMVTUWHCOHX-YUMQZZPRSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl ((1S,3S)-3-aminocyclopentyl)carbamate (CAS: 645400-44-8)?

tert-Butyl ((1S,3S)-3-aminocyclopentyl)carbamate is a white crystalline solid with a molecular weig...

Compound Q&A

What industries use tert-Butyl ((1S,3S)-3-aminocyclopentyl)carbamate (CAS: 645400-44-8)?

tert-Butyl ((1S,3S)-3-aminocyclopentyl)carbamate is used in the pharmaceutical industry for the syn...

Compound Q&A

What precautions should be taken when handling tert-Butyl ((1S,3S)-3-aminocyclopentyl)carbamate (CAS: 645400-44-8)?

Proper handling of tert-Butyl ((1S,3S)-3-aminocyclopentyl)carbamate requires the use of personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...